C32H49NO3 — CID 90843475
[(1S)-3-[2-[(1R,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] 4-cyanobutanoate (PubChem CID 90843475) has the molecular formula C32H49NO3 and a molecular weight of 495.75 g/mol. Its IUPAC name is [(1S)-3-[2-[(1R,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] 4-cyanobutanoate.
| Compound Name | [(1S)-3-[2-[(1R,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] 4-cyanobutanoate |
|---|---|
| PubChem CID | 90843475 |
| Molecular Formula | C32H49NO3 |
| Molecular Weight | 495.75 g/mol |
| Exact Mass | 495.37 |
| IUPAC Name | [(1S)-3-[2-[(1R,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] 4-cyanobutanoate |
| SMILES | C=C1CC[C@H](OC(=O)CCCC#N)CC1=CC=C1CCC[C@@]2(C)C1CC[C@@H]2[C@H](C)CCCC(C)(C)O |
| InChI | InChI=1S/C32H49NO3/c1-23-13-16-27(36-30(34)12-6-7-21-33)22-26(23)15-14-25-11-9-20-32(5)28(17-18-29(25)32)24(2)10-8-19-31(3,4)35/h14-15,24,27-29,35H,1,6-13,16-20,22H2,2-5H3/t24-,27+,28-,29?,32-/m1/s1 |
| InChIKey | HVROEWHQPDAJPU-MIISNDTHSA-N |
| XLogP | 7.98 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.75 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|