C30H47BrO3 — CID 118243817
[(1R,3Z)-3-[(2E)-2-[(1R,7aR)-1-[(2R)-6,6-dimethylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-hydroxy-4-methylidenecyclohexyl] 2-bromoacetate (PubChem CID 118243817) has the molecular formula C30H47BrO3 and a molecular weight of 535.61 g/mol. Its IUPAC name is [(1R,3Z)-3-[(2E)-2-[(1R,7aR)-1-[(2R)-6,6-dimethylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-hydroxy-4-methylidenecyclohexyl] 2-bromoacetate.
| Compound Name | [(1R,3Z)-3-[(2E)-2-[(1R,7aR)-1-[(2R)-6,6-dimethylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-hydroxy-4-methylidenecyclohexyl] 2-bromoacetate |
|---|---|
| PubChem CID | 118243817 |
| Molecular Formula | C30H47BrO3 |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | [(1R,3Z)-3-[(2E)-2-[(1R,7aR)-1-[(2R)-6,6-dimethylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-hydroxy-4-methylidenecyclohexyl] 2-bromoacetate |
| SMILES | C=C1/C(=C\C=C2/CCC[C@@]3(C)C2CC[C@@H]3[C@H](C)CCCC(C)(C)C)C[C@@H](OC(=O)CBr)CC1O |
| InChI | InChI=1S/C30H47BrO3/c1-20(9-7-15-29(3,4)5)25-13-14-26-22(10-8-16-30(25,26)6)11-12-23-17-24(34-28(33)19-31)18-27(32)21(23)2/h11-12,20,24-27,32H,2,7-10,13-19H2,1,3-6H3/b22-11+,23-12-/t20-,24-,25-,26?,27?,30-/m1/s1 |
| InChIKey | PIKJFNSDDSXFSK-CPGBATGHSA-N |
| XLogP | 7.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|