C19H33Br — CID 177463192
(1R,3aR,4Z,7aR)-4-(bromomethylidene)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 177463192) has the molecular formula C19H33Br and a molecular weight of 341.38 g/mol. Its IUPAC name is (1R,3aR,4Z,7aR)-4-(bromomethylidene)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | (1R,3aR,4Z,7aR)-4-(bromomethylidene)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 177463192 |
| Molecular Formula | C19H33Br |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (1R,3aR,4Z,7aR)-4-(bromomethylidene)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2/C(=C\Br)CCC[C@]12C |
| InChI | InChI=1S/C19H33Br/c1-14(2)7-5-8-15(3)17-10-11-18-16(13-20)9-6-12-19(17,18)4/h13-15,17-18H,5-12H2,1-4H3/b16-13-/t15-,17-,18+,19-/m1/s1 |
| InChIKey | VZXFEMMINUDNAI-PHJJIZLPSA-N |
| XLogP | 6.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |