C16H25BrO — CID 54226923
(4R)-4-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]pentanal (PubChem CID 54226923) has the molecular formula C16H25BrO and a molecular weight of 313.28 g/mol. Its IUPAC name is (4R)-4-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]pentanal.
| Compound Name | (4R)-4-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]pentanal |
|---|---|
| PubChem CID | 54226923 |
| Molecular Formula | C16H25BrO |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (4R)-4-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]pentanal |
| SMILES | C[C@H](CCC=O)[C@H]1CCC2C(=CBr)CCC[C@@]21C |
| InChI | InChI=1S/C16H25BrO/c1-12(5-4-10-18)14-7-8-15-13(11-17)6-3-9-16(14,15)2/h10-12,14-15H,3-9H2,1-2H3/t12-,14-,15?,16-/m1/s1 |
| InChIKey | QGMIQHWITQKWIC-FZLHRTGXSA-N |
| XLogP | 5.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|