C25H45BrO3Si — CID 173275145
(2R,6R)-6-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-tert-butyl-3-dimethylsilyloxy-2-methylheptanoic acid (PubChem CID 173275145) has the molecular formula C25H45BrO3Si and a molecular weight of 501.62 g/mol. Its IUPAC name is (2R,6R)-6-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-tert-butyl-3-dimethylsilyloxy-2-methylheptanoic acid.
| Compound Name | (2R,6R)-6-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-tert-butyl-3-dimethylsilyloxy-2-methylheptanoic acid |
|---|---|
| PubChem CID | 173275145 |
| Molecular Formula | C25H45BrO3Si |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | (2R,6R)-6-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-tert-butyl-3-dimethylsilyloxy-2-methylheptanoic acid |
| SMILES | C[C@H](CCC(O[SiH](C)C)[C@](C)(C(=O)O)C(C)(C)C)[C@H]1CCC2C(=CBr)CCC[C@@]21C |
| InChI | InChI=1S/C25H45BrO3Si/c1-17(19-12-13-20-18(16-26)10-9-15-24(19,20)5)11-14-21(29-30(7)8)25(6,22(27)28)23(2,3)4/h16-17,19-21,30H,9-15H2,1-8H3,(H,27,28)/t17-,19-,20?,21?,24-,25-/m1/s1 |
| InChIKey | DTOMVCYAKHJKFU-XYJFKWKASA-N |
| XLogP | 7.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|