C28H47BrO3 — CID 11995230
[(3R,4R,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-4-hydroxy-2-methylidene-3-(2-methylpropyl)heptyl] 2,2-dimethylpropanoate (PubChem CID 11995230) has the molecular formula C28H47BrO3 and a molecular weight of 511.59 g/mol. Its IUPAC name is [(3R,4R,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-4-hydroxy-2-methylidene-3-(2-methylpropyl)heptyl] 2,2-dimethylpropanoate.
| Compound Name | [(3R,4R,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-4-hydroxy-2-methylidene-3-(2-methylpropyl)heptyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11995230 |
| Molecular Formula | C28H47BrO3 |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | [(3R,4R,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-4-hydroxy-2-methylidene-3-(2-methylpropyl)heptyl] 2,2-dimethylpropanoate |
| SMILES | C=C(COC(=O)C(C)(C)C)[C@@H](CC(C)C)[C@H](O)C[C@@H](C)[C@H]1CC[C@H]2/C(=C/Br)CCC[C@]12C |
| InChI | InChI=1S/C28H47BrO3/c1-18(2)14-22(20(4)17-32-26(31)27(5,6)7)25(30)15-19(3)23-11-12-24-21(16-29)10-9-13-28(23,24)8/h16,18-19,22-25,30H,4,9-15,17H2,1-3,5-8H3/b21-16+/t19-,22-,23-,24+,25-,28-/m1/s1 |
| InChIKey | UOZBPXVPHKOWOS-WKBNSZDFSA-N |
| XLogP | 7.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|