C23H39BrO2 — CID 90725383
(3S,4S,6R)-6-[(1R,3aR,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-butyl-2-methylideneheptane-1,4-diol (PubChem CID 90725383) has the molecular formula C23H39BrO2 and a molecular weight of 427.47 g/mol. Its IUPAC name is (3S,4S,6R)-6-[(1R,3aR,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-butyl-2-methylideneheptane-1,4-diol.
| Compound Name | (3S,4S,6R)-6-[(1R,3aR,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-butyl-2-methylideneheptane-1,4-diol |
|---|---|
| PubChem CID | 90725383 |
| Molecular Formula | C23H39BrO2 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | (3S,4S,6R)-6-[(1R,3aR,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-butyl-2-methylideneheptane-1,4-diol |
| SMILES | C=C(CO)[C@H](CCCC)[C@@H](O)C[C@@H](C)[C@H]1CC[C@H]2C(=CBr)CCC[C@]12C |
| InChI | InChI=1S/C23H39BrO2/c1-5-6-9-19(17(3)15-25)22(26)13-16(2)20-10-11-21-18(14-24)8-7-12-23(20,21)4/h14,16,19-22,25-26H,3,5-13,15H2,1-2,4H3/t16-,19+,20-,21+,22+,23-/m1/s1 |
| InChIKey | HWNISPNYJWKXEK-SKUFLTFTSA-N |
| XLogP | 6.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|