C21H33BrO2 — CID 134972028
(1S,3R)-3-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1-[1-(3-hydroxyprop-1-en-2-yl)cyclopropyl]butan-1-ol (PubChem CID 134972028) has the molecular formula C21H33BrO2 and a molecular weight of 397.40 g/mol. Its IUPAC name is (1S,3R)-3-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1-[1-(3-hydroxyprop-1-en-2-yl)cyclopropyl]butan-1-ol.
| Compound Name | (1S,3R)-3-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1-[1-(3-hydroxyprop-1-en-2-yl)cyclopropyl]butan-1-ol |
|---|---|
| PubChem CID | 134972028 |
| Molecular Formula | C21H33BrO2 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | (1S,3R)-3-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1-[1-(3-hydroxyprop-1-en-2-yl)cyclopropyl]butan-1-ol |
| SMILES | C=C(CO)C1([C@@H](O)C[C@@H](C)[C@H]2CC[C@H]3/C(=C/Br)CCC[C@]23C)CC1 |
| InChI | InChI=1S/C21H33BrO2/c1-14(11-19(24)21(9-10-21)15(2)13-23)17-6-7-18-16(12-22)5-4-8-20(17,18)3/h12,14,17-19,23-24H,2,4-11,13H2,1,3H3/b16-12+/t14-,17-,18+,19+,20-/m1/s1 |
| InChIKey | YEDLBCQAECTOOA-CNFDYBQKSA-N |
| XLogP | 5.20 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|