C23H35BrO2 — CID 11995432
(4S,5R)-5-[(2R)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methylidene-4-(2-methylpropyl)oxolan-2-one (PubChem CID 11995432) has the molecular formula C23H35BrO2 and a molecular weight of 423.44 g/mol. Its IUPAC name is (4S,5R)-5-[(2R)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methylidene-4-(2-methylpropyl)oxolan-2-one.
| Compound Name | (4S,5R)-5-[(2R)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methylidene-4-(2-methylpropyl)oxolan-2-one |
|---|---|
| PubChem CID | 11995432 |
| Molecular Formula | C23H35BrO2 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (4S,5R)-5-[(2R)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methylidene-4-(2-methylpropyl)oxolan-2-one |
| SMILES | C=C1C(=O)O[C@H](C[C@@H](C)[C@H]2CC[C@H]3/C(=C/Br)CCC[C@]23C)[C@H]1CC(C)C |
| InChI | InChI=1S/C23H35BrO2/c1-14(2)11-18-16(4)22(25)26-21(18)12-15(3)19-8-9-20-17(13-24)7-6-10-23(19,20)5/h13-15,18-21H,4,6-12H2,1-3,5H3/b17-13+/t15-,18+,19-,20+,21-,23-/m1/s1 |
| InChIKey | MRICNRJWLNDTFR-BRMRAZNBSA-N |
| XLogP | 6.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|