C22H33BrO2 — CID 11994890
(4R,5R)-5-[(2R)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methylidene-4-propyloxolan-2-one (PubChem CID 11994890) has the molecular formula C22H33BrO2 and a molecular weight of 409.41 g/mol. Its IUPAC name is (4R,5R)-5-[(2R)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methylidene-4-propyloxolan-2-one.
| Compound Name | (4R,5R)-5-[(2R)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methylidene-4-propyloxolan-2-one |
|---|---|
| PubChem CID | 11994890 |
| Molecular Formula | C22H33BrO2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | (4R,5R)-5-[(2R)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methylidene-4-propyloxolan-2-one |
| SMILES | C=C1C(=O)O[C@H](C[C@@H](C)[C@H]2CC[C@H]3/C(=C/Br)CCC[C@]23C)[C@@H]1CCC |
| InChI | InChI=1S/C22H33BrO2/c1-5-7-17-15(3)21(24)25-20(17)12-14(2)18-9-10-19-16(13-23)8-6-11-22(18,19)4/h13-14,17-20H,3,5-12H2,1-2,4H3/b16-13+/t14-,17-,18-,19+,20-,22-/m1/s1 |
| InChIKey | LXOXVLSXJXPUJC-MIUAUYCMSA-N |
| XLogP | 6.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|