C21H31BrO2 — CID 91145922
(4R,5R)-5-[(2R)-2-[(1R,3aR,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-4-ethyl-3-methylideneoxolan-2-one (PubChem CID 91145922) has the molecular formula C21H31BrO2 and a molecular weight of 395.38 g/mol. Its IUPAC name is (4R,5R)-5-[(2R)-2-[(1R,3aR,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-4-ethyl-3-methylideneoxolan-2-one.
| Compound Name | (4R,5R)-5-[(2R)-2-[(1R,3aR,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-4-ethyl-3-methylideneoxolan-2-one |
|---|---|
| PubChem CID | 91145922 |
| Molecular Formula | C21H31BrO2 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (4R,5R)-5-[(2R)-2-[(1R,3aR,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-4-ethyl-3-methylideneoxolan-2-one |
| SMILES | C=C1C(=O)O[C@H](C[C@@H](C)[C@H]2CC[C@H]3C(=CBr)CCC[C@]23C)[C@@H]1CC |
| InChI | InChI=1S/C21H31BrO2/c1-5-16-14(3)20(23)24-19(16)11-13(2)17-8-9-18-15(12-22)7-6-10-21(17,18)4/h12-13,16-19H,3,5-11H2,1-2,4H3/t13-,16-,17-,18+,19-,21-/m1/s1 |
| InChIKey | SHFLALSIJFVQGM-JKELCNRMSA-N |
| XLogP | 6.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|