C20H29BrO2 — CID 58668259
(4S,5R)-5-[(2R)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-4-methyl-3-methylideneoxolan-2-one (PubChem CID 58668259) has the molecular formula C20H29BrO2 and a molecular weight of 381.35 g/mol. Its IUPAC name is (4S,5R)-5-[(2R)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-4-methyl-3-methylideneoxolan-2-one.
| Compound Name | (4S,5R)-5-[(2R)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-4-methyl-3-methylideneoxolan-2-one |
|---|---|
| PubChem CID | 58668259 |
| Molecular Formula | C20H29BrO2 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | (4S,5R)-5-[(2R)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-4-methyl-3-methylideneoxolan-2-one |
| SMILES | C=C1C(=O)O[C@H](C[C@@H](C)[C@H]2CC[C@H]3/C(=C/Br)CCC[C@]23C)[C@H]1C |
| InChI | InChI=1S/C20H29BrO2/c1-12(10-18-13(2)14(3)19(22)23-18)16-7-8-17-15(11-21)6-5-9-20(16,17)4/h11-13,16-18H,3,5-10H2,1-2,4H3/b15-11+/t12-,13+,16-,17+,18-,20-/m1/s1 |
| InChIKey | ZZMRUJKWTPPQDF-KEBSLGDESA-N |
| XLogP | 5.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|