C21H35BrO2 — CID 118213826
(4R,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3,3-dimethyl-2-methylideneheptane-1,4-diol (PubChem CID 118213826) has the molecular formula C21H35BrO2 and a molecular weight of 399.41 g/mol. Its IUPAC name is (4R,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3,3-dimethyl-2-methylideneheptane-1,4-diol.
| Compound Name | (4R,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3,3-dimethyl-2-methylideneheptane-1,4-diol |
|---|---|
| PubChem CID | 118213826 |
| Molecular Formula | C21H35BrO2 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | (4R,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3,3-dimethyl-2-methylideneheptane-1,4-diol |
| SMILES | C=C(CO)C(C)(C)[C@H](O)C[C@@H](C)[C@H]1CC[C@H]2/C(=C/Br)CCC[C@]12C |
| InChI | InChI=1S/C21H35BrO2/c1-14(11-19(24)20(3,4)15(2)13-23)17-8-9-18-16(12-22)7-6-10-21(17,18)5/h12,14,17-19,23-24H,2,6-11,13H2,1,3-5H3/b16-12+/t14-,17-,18+,19-,21-/m1/s1 |
| InChIKey | RIYSZKAQHGECNZ-MUIGMZJSSA-N |
| XLogP | 5.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|