C16H28O — CID 59761068
(2E)-2-[(1R,3aS,7aR)-1-[(2S)-butan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethanol (PubChem CID 59761068) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is (2E)-2-[(1R,3aS,7aR)-1-[(2S)-butan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethanol.
| Compound Name | (2E)-2-[(1R,3aS,7aR)-1-[(2S)-butan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethanol |
|---|---|
| PubChem CID | 59761068 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | (2E)-2-[(1R,3aS,7aR)-1-[(2S)-butan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethanol |
| SMILES | CC[C@H](C)[C@H]1CC[C@H]2/C(=C/CO)CCC[C@]12C |
| InChI | InChI=1S/C16H28O/c1-4-12(2)14-7-8-15-13(9-11-17)6-5-10-16(14,15)3/h9,12,14-15,17H,4-8,10-11H2,1-3H3/b13-9+/t12-,14+,15-,16+/m0/s1 |
| InChIKey | HGEPISOWWLWGQQ-HFRMNUNXSA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|