C20H31IO2 — CID 142927636
(3S,6R)-6-[(1R,4E,7aR)-4-(iodomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-methyl-2-methylideneheptanoic acid (PubChem CID 142927636) has the molecular formula C20H31IO2 and a molecular weight of 430.37 g/mol. Its IUPAC name is (3S,6R)-6-[(1R,4E,7aR)-4-(iodomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-methyl-2-methylideneheptanoic acid.
| Compound Name | (3S,6R)-6-[(1R,4E,7aR)-4-(iodomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-methyl-2-methylideneheptanoic acid |
|---|---|
| PubChem CID | 142927636 |
| Molecular Formula | C20H31IO2 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | (3S,6R)-6-[(1R,4E,7aR)-4-(iodomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-methyl-2-methylideneheptanoic acid |
| SMILES | C=C(C(=O)O)[C@@H](C)CC[C@@H](C)[C@H]1CCC2/C(=C/I)CCC[C@@]21C |
| InChI | InChI=1S/C20H31IO2/c1-13(15(3)19(22)23)7-8-14(2)17-9-10-18-16(12-21)6-5-11-20(17,18)4/h12-14,17-18H,3,5-11H2,1-2,4H3,(H,22,23)/b16-12+/t13-,14+,17+,18?,20+/m0/s1 |
| InChIKey | IGSQVFWKOMAZDH-WWPJCLIXSA-N |
| XLogP | 6.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|