C19H29IO2 — CID 70216088
(3S,5R)-5-[(2R)-2-[(1R,7aR)-4-(iodomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methyloxolan-2-one (PubChem CID 70216088) has the molecular formula C19H29IO2 and a molecular weight of 416.34 g/mol. Its IUPAC name is (3S,5R)-5-[(2R)-2-[(1R,7aR)-4-(iodomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methyloxolan-2-one.
| Compound Name | (3S,5R)-5-[(2R)-2-[(1R,7aR)-4-(iodomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methyloxolan-2-one |
|---|---|
| PubChem CID | 70216088 |
| Molecular Formula | C19H29IO2 |
| Molecular Weight | 416.34 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | (3S,5R)-5-[(2R)-2-[(1R,7aR)-4-(iodomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methyloxolan-2-one |
| SMILES | C[C@H](C[C@@H]1C[C@H](C)C(=O)O1)[C@H]1CCC2C(=CI)CCC[C@@]21C |
| InChI | InChI=1S/C19H29IO2/c1-12(9-15-10-13(2)18(21)22-15)16-6-7-17-14(11-20)5-4-8-19(16,17)3/h11-13,15-17H,4-10H2,1-3H3/t12-,13+,15-,16-,17?,19-/m1/s1 |
| InChIKey | LHMNRCGFPBJVGV-NSGSNIPRSA-N |
| XLogP | 5.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.34 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|