C18H26O3 — CID 70187172
(5S)-5-[(2R)-2-[(1R)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methylideneoxolan-2-one (PubChem CID 70187172) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (5S)-5-[(2R)-2-[(1R)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methylideneoxolan-2-one.
| Compound Name | (5S)-5-[(2R)-2-[(1R)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methylideneoxolan-2-one |
|---|---|
| PubChem CID | 70187172 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (5S)-5-[(2R)-2-[(1R)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methylideneoxolan-2-one |
| SMILES | C=C1C[C@H](C[C@@H](C)[C@H]2CCC3C(=O)CCCC32C)OC1=O |
| InChI | InChI=1S/C18H26O3/c1-11(9-13-10-12(2)17(20)21-13)14-6-7-15-16(19)5-4-8-18(14,15)3/h11,13-15H,2,4-10H2,1,3H3/t11-,13+,14-,15?,18?/m1/s1 |
| InChIKey | AQRRLSZXZCNTED-WMEBNPGQSA-N |
| XLogP | 3.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|