C24H42O3Si — CID 70221028
(5R)-5-[(2R)-2-[(1R,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl]-3-methylideneoxolan-2-one (PubChem CID 70221028) has the molecular formula C24H42O3Si and a molecular weight of 406.68 g/mol. Its IUPAC name is (5R)-5-[(2R)-2-[(1R,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl]-3-methylideneoxolan-2-one.
| Compound Name | (5R)-5-[(2R)-2-[(1R,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl]-3-methylideneoxolan-2-one |
|---|---|
| PubChem CID | 70221028 |
| Molecular Formula | C24H42O3Si |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | (5R)-5-[(2R)-2-[(1R,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl]-3-methylideneoxolan-2-one |
| SMILES | C=C1C[C@@H](C[C@@H](C)[C@H]2CCC3C(O[Si](C)(C)C(C)(C)C)CCC[C@@]32C)OC1=O |
| InChI | InChI=1S/C24H42O3Si/c1-16(14-18-15-17(2)22(25)26-18)19-11-12-20-21(10-9-13-24(19,20)6)27-28(7,8)23(3,4)5/h16,18-21H,2,9-15H2,1,3-8H3/t16-,18-,19-,20?,21?,24-/m1/s1 |
| InChIKey | FBINFIPFLWBUJK-NJYJUPLNSA-N |
| XLogP | 6.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|