C21H38OSi — CID 174105626
[(1R,3aR,4S,7aR)-7a-methyl-1-pent-4-yn-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 174105626) has the molecular formula C21H38OSi and a molecular weight of 334.62 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-7a-methyl-1-pent-4-yn-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,3aR,4S,7aR)-7a-methyl-1-pent-4-yn-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 174105626 |
| Molecular Formula | C21H38OSi |
| Molecular Weight | 334.62 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | [(1R,3aR,4S,7aR)-7a-methyl-1-pent-4-yn-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C#CCC(C)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C21H38OSi/c1-9-11-16(2)17-13-14-18-19(12-10-15-21(17,18)6)22-23(7,8)20(3,4)5/h1,16-19H,10-15H2,2-8H3/t16?,17-,18+,19+,21-/m1/s1 |
| InChIKey | GXXLBZJIDHHIEU-LRHTYFCCSA-N |
| XLogP | 6.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.62 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|