C24H46O3Si — CID 171618428
ethyl (5R)-5-[(1R,3aR,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]hexanoate (PubChem CID 171618428) has the molecular formula C24H46O3Si and a molecular weight of 410.72 g/mol. Its IUPAC name is ethyl (5R)-5-[(1R,3aR,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]hexanoate.
| Compound Name | ethyl (5R)-5-[(1R,3aR,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]hexanoate |
|---|---|
| PubChem CID | 171618428 |
| Molecular Formula | C24H46O3Si |
| Molecular Weight | 410.72 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | ethyl (5R)-5-[(1R,3aR,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]hexanoate |
| SMILES | CCOC(=O)CCC[C@@H](C)[C@H]1CC[C@H]2C(O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C24H46O3Si/c1-9-26-22(25)14-10-12-18(2)19-15-16-20-21(13-11-17-24(19,20)6)27-28(7,8)23(3,4)5/h18-21H,9-17H2,1-8H3/t18-,19-,20+,21?,24-/m1/s1 |
| InChIKey | FXUDDVCIKIJVNU-LOTQQTSYSA-N |
| XLogP | 6.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.72 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|