C24H46O3Si — CID 70935610
6-[(7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-hydroxy-2-methylheptan-3-one (PubChem CID 70935610) has the molecular formula C24H46O3Si and a molecular weight of 410.72 g/mol. Its IUPAC name is 6-[(7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-hydroxy-2-methylheptan-3-one.
| Compound Name | 6-[(7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-hydroxy-2-methylheptan-3-one |
|---|---|
| PubChem CID | 70935610 |
| Molecular Formula | C24H46O3Si |
| Molecular Weight | 410.72 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | 6-[(7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-hydroxy-2-methylheptan-3-one |
| SMILES | CC[Si](CC)(CC)OC1CCC[C@]2(C)C(C(C)CCC(=O)C(C)(C)O)CCC12 |
| InChI | InChI=1S/C24H46O3Si/c1-8-28(9-2,10-3)27-21-12-11-17-24(7)19(14-15-20(21)24)18(4)13-16-22(25)23(5,6)26/h18-21,26H,8-17H2,1-7H3/t18?,19?,20?,21?,24-/m1/s1 |
| InChIKey | KNEOWUUDPAVUIP-WUACOWEFSA-N |
| XLogP | 6.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.72 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|