C26H50O3Si — CID 140656104
7-[(1R,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-ethyl-3-hydroxyoctan-4-one (PubChem CID 140656104) has the molecular formula C26H50O3Si and a molecular weight of 438.77 g/mol. Its IUPAC name is 7-[(1R,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-ethyl-3-hydroxyoctan-4-one.
| Compound Name | 7-[(1R,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-ethyl-3-hydroxyoctan-4-one |
|---|---|
| PubChem CID | 140656104 |
| Molecular Formula | C26H50O3Si |
| Molecular Weight | 438.77 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | 7-[(1R,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-ethyl-3-hydroxyoctan-4-one |
| SMILES | CCC(O)(CC)C(=O)CCC(C)[C@H]1CCC2C(O[Si](CC)(CC)CC)CCC[C@@]21C |
| InChI | InChI=1S/C26H50O3Si/c1-8-26(28,9-2)24(27)18-15-20(6)21-16-17-22-23(14-13-19-25(21,22)7)29-30(10-3,11-4)12-5/h20-23,28H,8-19H2,1-7H3/t20?,21-,22?,23?,25-/m1/s1 |
| InChIKey | XIOBPZRKLSOBBJ-UEIJXTNOSA-N |
| XLogP | 7.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.77 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|