C21H39NOSi — CID 174053985
4-[(1R,4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentanenitrile (PubChem CID 174053985) has the molecular formula C21H39NOSi and a molecular weight of 349.64 g/mol. Its IUPAC name is 4-[(1R,4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentanenitrile.
| Compound Name | 4-[(1R,4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentanenitrile |
|---|---|
| PubChem CID | 174053985 |
| Molecular Formula | C21H39NOSi |
| Molecular Weight | 349.64 g/mol |
| Exact Mass | 349.28 |
| IUPAC Name | 4-[(1R,4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentanenitrile |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCC[C@@]2(C)C1CC[C@@H]2C(C)CCC#N |
| InChI | InChI=1S/C21H39NOSi/c1-6-24(7-2,8-3)23-20-12-9-15-21(5)18(13-14-19(20)21)17(4)11-10-16-22/h17-20H,6-15H2,1-5H3/t17?,18-,19?,20+,21-/m1/s1 |
| InChIKey | IOVSQLLOGWFVGS-YCHQTSKFSA-N |
| XLogP | 6.53 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.64 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|