C25H50OSi — CID 67747448
[(1R,3aR,4S,7aR)-1-[(2S)-6,6-dimethylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 67747448) has the molecular formula C25H50OSi and a molecular weight of 394.76 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-1-[(2S)-6,6-dimethylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,3aR,4S,7aR)-1-[(2S)-6,6-dimethylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 67747448 |
| Molecular Formula | C25H50OSi |
| Molecular Weight | 394.76 g/mol |
| Exact Mass | 394.36 |
| IUPAC Name | [(1R,3aR,4S,7aR)-1-[(2S)-6,6-dimethylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@@H](CCCC(C)(C)C)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C25H50OSi/c1-19(13-11-17-23(2,3)4)20-15-16-21-22(14-12-18-25(20,21)8)26-27(9,10)24(5,6)7/h19-22H,11-18H2,1-10H3/t19-,20+,21-,22-,25+/m0/s1 |
| InChIKey | DCCPELDXFPTZAR-NPKKMJAZSA-N |
| XLogP | 8.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.76 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|