C24H47IO2Si — CID 71662955
(6S)-6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-7-iodo-2-methylheptan-2-ol (PubChem CID 71662955) has the molecular formula C24H47IO2Si and a molecular weight of 522.63 g/mol. Its IUPAC name is (6S)-6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-7-iodo-2-methylheptan-2-ol.
| Compound Name | (6S)-6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-7-iodo-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 71662955 |
| Molecular Formula | C24H47IO2Si |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | (6S)-6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-7-iodo-2-methylheptan-2-ol |
| SMILES | CC(C)(O)CCC[C@H](CI)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C24H47IO2Si/c1-22(2,3)28(7,8)27-21-12-10-16-24(6)19(13-14-20(21)24)18(17-25)11-9-15-23(4,5)26/h18-21,26H,9-17H2,1-8H3/t18-,19-,20+,21+,24-/m1/s1 |
| InChIKey | DGQLEXMRZUHONZ-UVSNUMOOSA-N |
| XLogP | 7.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|