C26H50O3Si — CID 86629404
(3R)-3-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-7-hydroxy-3,7-dimethyloctanal (PubChem CID 86629404) has the molecular formula C26H50O3Si and a molecular weight of 438.77 g/mol. Its IUPAC name is (3R)-3-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-7-hydroxy-3,7-dimethyloctanal.
| Compound Name | (3R)-3-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-7-hydroxy-3,7-dimethyloctanal |
|---|---|
| PubChem CID | 86629404 |
| Molecular Formula | C26H50O3Si |
| Molecular Weight | 438.77 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | (3R)-3-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-7-hydroxy-3,7-dimethyloctanal |
| SMILES | CC(C)(O)CCC[C@](C)(CC=O)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C26H50O3Si/c1-23(2,3)30(8,9)29-21-12-10-17-26(7)20(21)13-14-22(26)25(6,18-19-27)16-11-15-24(4,5)28/h19-22,28H,10-18H2,1-9H3/t20-,21-,22+,25+,26-/m0/s1 |
| InChIKey | ZEEZCBUUBWUJIS-LNGSMSGUSA-N |
| XLogP | 7.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.77 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|