C28H56O3Si — CID 21462545
6-[2-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methylpropoxy]-3-ethylhexan-3-ol (PubChem CID 21462545) has the molecular formula C28H56O3Si and a molecular weight of 468.84 g/mol. Its IUPAC name is 6-[2-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methylpropoxy]-3-ethylhexan-3-ol.
| Compound Name | 6-[2-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methylpropoxy]-3-ethylhexan-3-ol |
|---|---|
| PubChem CID | 21462545 |
| Molecular Formula | C28H56O3Si |
| Molecular Weight | 468.84 g/mol |
| Exact Mass | 468.40 |
| IUPAC Name | 6-[2-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methylpropoxy]-3-ethylhexan-3-ol |
| SMILES | CCC(O)(CC)CCCOCC(C)(C)C1CCC2C(O[Si](C)(C)C(C)(C)C)CCCC21C |
| InChI | InChI=1S/C28H56O3Si/c1-11-28(29,12-2)19-14-20-30-21-26(6,7)24-17-16-22-23(15-13-18-27(22,24)8)31-32(9,10)25(3,4)5/h22-24,29H,11-21H2,1-10H3 |
| InChIKey | LVONFAJYAFCJDR-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.84 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|