C25H48O3Si — CID 67998305
1-[(3S,5S)-5-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-5-methyloxolan-3-yl]-2-methylpropan-2-ol (PubChem CID 67998305) has the molecular formula C25H48O3Si and a molecular weight of 424.74 g/mol. Its IUPAC name is 1-[(3S,5S)-5-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-5-methyloxolan-3-yl]-2-methylpropan-2-ol.
| Compound Name | 1-[(3S,5S)-5-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-5-methyloxolan-3-yl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 67998305 |
| Molecular Formula | C25H48O3Si |
| Molecular Weight | 424.74 g/mol |
| Exact Mass | 424.34 |
| IUPAC Name | 1-[(3S,5S)-5-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-5-methyloxolan-3-yl]-2-methylpropan-2-ol |
| SMILES | CC(C)(O)C[C@@H]1CO[C@](C)(C2CCC3C(O[Si](C)(C)C(C)(C)C)CCCC32C)C1 |
| InChI | InChI=1S/C25H48O3Si/c1-22(2,3)29(8,9)28-20-11-10-14-24(6)19(20)12-13-21(24)25(7)16-18(17-27-25)15-23(4,5)26/h18-21,26H,10-17H2,1-9H3/t18-,19?,20?,21?,24?,25-/m0/s1 |
| InChIKey | SGBWVVXKESEPAC-KBTUPMSQSA-N |
| XLogP | 6.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.74 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|