C24H44O3Si — CID 68585378
methyl 4-[1-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]cyclopropyl]butanoate (PubChem CID 68585378) has the molecular formula C24H44O3Si and a molecular weight of 408.70 g/mol. Its IUPAC name is methyl 4-[1-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]cyclopropyl]butanoate.
| Compound Name | methyl 4-[1-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]cyclopropyl]butanoate |
|---|---|
| PubChem CID | 68585378 |
| Molecular Formula | C24H44O3Si |
| Molecular Weight | 408.70 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | methyl 4-[1-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]cyclopropyl]butanoate |
| SMILES | COC(=O)CCCC1([C@H]2CC[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]23C)CC1 |
| InChI | InChI=1S/C24H44O3Si/c1-22(2,3)28(6,7)27-19-10-8-14-23(4)18(19)12-13-20(23)24(16-17-24)15-9-11-21(25)26-5/h18-20H,8-17H2,1-7H3/t18-,19-,20-,23-/m0/s1 |
| InChIKey | XBEDHOAXJCAOHA-MXBUBSDBSA-N |
| XLogP | 6.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.70 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|