C23H42FNO3Si — CID 76635178
4-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4-fluoro-N-methoxy-N-methylpent-2-enamide (PubChem CID 76635178) has the molecular formula C23H42FNO3Si and a molecular weight of 427.68 g/mol. Its IUPAC name is 4-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4-fluoro-N-methoxy-N-methylpent-2-enamide.
| Compound Name | 4-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4-fluoro-N-methoxy-N-methylpent-2-enamide |
|---|---|
| PubChem CID | 76635178 |
| Molecular Formula | C23H42FNO3Si |
| Molecular Weight | 427.68 g/mol |
| Exact Mass | 427.29 |
| IUPAC Name | 4-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4-fluoro-N-methoxy-N-methylpent-2-enamide |
| SMILES | CON(C)C(=O)C=CC(C)(F)C1CCC2C(O[Si](C)(C)C(C)(C)C)CCCC21C |
| InChI | InChI=1S/C23H42FNO3Si/c1-21(2,3)29(8,9)28-18-11-10-15-22(4)17(18)12-13-19(22)23(5,24)16-14-20(26)25(6)27-7/h14,16-19H,10-13,15H2,1-9H3 |
| InChIKey | LGTJTSUDLYGQRS-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.68 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|