C29H56O3Si — CID 53474440
[(1S,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methyl-6-(oxan-2-yloxy)heptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 53474440) has the molecular formula C29H56O3Si and a molecular weight of 480.85 g/mol. Its IUPAC name is [(1S,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methyl-6-(oxan-2-yloxy)heptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methyl-6-(oxan-2-yloxy)heptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 53474440 |
| Molecular Formula | C29H56O3Si |
| Molecular Weight | 480.85 g/mol |
| Exact Mass | 480.40 |
| IUPAC Name | [(1S,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methyl-6-(oxan-2-yloxy)heptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@H](CCCC(C)(C)OC1CCCCO1)[C@@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C29H56O3Si/c1-22(14-12-19-28(5,6)31-26-16-10-11-21-30-26)23-17-18-24-25(15-13-20-29(23,24)7)32-33(8,9)27(2,3)4/h22-26H,10-21H2,1-9H3/t22-,23+,24+,25+,26?,29-/m1/s1 |
| InChIKey | IQGXDDSREAGDDE-CADNRFPESA-N |
| XLogP | 8.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.85 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|