C25H48O3Si — CID 53259772
[(2R,3R)-3-[(4R)-4-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentyl]-3-methyloxiran-2-yl]methanol (PubChem CID 53259772) has the molecular formula C25H48O3Si and a molecular weight of 424.74 g/mol. Its IUPAC name is [(2R,3R)-3-[(4R)-4-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentyl]-3-methyloxiran-2-yl]methanol.
| Compound Name | [(2R,3R)-3-[(4R)-4-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentyl]-3-methyloxiran-2-yl]methanol |
|---|---|
| PubChem CID | 53259772 |
| Molecular Formula | C25H48O3Si |
| Molecular Weight | 424.74 g/mol |
| Exact Mass | 424.34 |
| IUPAC Name | [(2R,3R)-3-[(4R)-4-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentyl]-3-methyloxiran-2-yl]methanol |
| SMILES | C[C@H](CCC[C@@]1(C)O[C@@H]1CO)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C25H48O3Si/c1-18(11-9-16-25(6)22(17-26)27-25)19-13-14-20-21(12-10-15-24(19,20)5)28-29(7,8)23(2,3)4/h18-22,26H,9-17H2,1-8H3/t18-,19-,20+,21+,22-,24-,25-/m1/s1 |
| InChIKey | KLHAZJLARNXJKJ-NWLGIRGFSA-N |
| XLogP | 6.55 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.74 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|