C24H44O2Si — CID 140598317
6-[(7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methylhept-3-yn-2-ol (PubChem CID 140598317) has the molecular formula C24H44O2Si and a molecular weight of 392.70 g/mol. Its IUPAC name is 6-[(7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methylhept-3-yn-2-ol.
| Compound Name | 6-[(7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methylhept-3-yn-2-ol |
|---|---|
| PubChem CID | 140598317 |
| Molecular Formula | C24H44O2Si |
| Molecular Weight | 392.70 g/mol |
| Exact Mass | 392.31 |
| IUPAC Name | 6-[(7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methylhept-3-yn-2-ol |
| SMILES | CC[Si](CC)(CC)OC1CCC[C@]2(C)C(C(C)CC#CC(C)(C)O)CCC12 |
| InChI | InChI=1S/C24H44O2Si/c1-8-27(9-2,10-3)26-22-14-12-18-24(7)20(15-16-21(22)24)19(4)13-11-17-23(5,6)25/h19-22,25H,8-10,12-16,18H2,1-7H3/t19?,20?,21?,22?,24-/m1/s1 |
| InChIKey | SNUJTQQZXRRZKK-GGGBIRNISA-N |
| XLogP | 6.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.70 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|