C18H31O2P — CID 59880304
(1R,7aR)-7a-methyl-1-[(2R)-6-methyl-6-phosphanyloxyhept-4-yn-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 59880304) has the molecular formula C18H31O2P and a molecular weight of 310.42 g/mol. Its IUPAC name is (1R,7aR)-7a-methyl-1-[(2R)-6-methyl-6-phosphanyloxyhept-4-yn-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | (1R,7aR)-7a-methyl-1-[(2R)-6-methyl-6-phosphanyloxyhept-4-yn-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 59880304 |
| Molecular Formula | C18H31O2P |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | (1R,7aR)-7a-methyl-1-[(2R)-6-methyl-6-phosphanyloxyhept-4-yn-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | C[C@H](CC#CC(C)(C)OP)[C@H]1CCC2C(O)CCC[C@@]21C |
| InChI | InChI=1S/C18H31O2P/c1-13(7-5-11-17(2,3)20-21)14-9-10-15-16(19)8-6-12-18(14,15)4/h13-16,19H,6-10,12,21H2,1-4H3/t13-,14-,15?,16?,18-/m1/s1 |
| InChIKey | YNIKUTRQQPBOKH-ALFILNPMSA-N |
| XLogP | 4.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|