C19H34O3 — CID 70935598
6-[(7aR)-4-methoxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-hydroxy-2-methylheptan-3-one (PubChem CID 70935598) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is 6-[(7aR)-4-methoxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-hydroxy-2-methylheptan-3-one.
| Compound Name | 6-[(7aR)-4-methoxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-hydroxy-2-methylheptan-3-one |
|---|---|
| PubChem CID | 70935598 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | 6-[(7aR)-4-methoxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-hydroxy-2-methylheptan-3-one |
| SMILES | COC1CCC[C@]2(C)C(C(C)CCC(=O)C(C)(C)O)CCC12 |
| InChI | InChI=1S/C19H34O3/c1-13(8-11-17(20)18(2,3)21)14-9-10-15-16(22-5)7-6-12-19(14,15)4/h13-16,21H,6-12H2,1-5H3/t13?,14?,15?,16?,19-/m1/s1 |
| InChIKey | ZDEGIZZDXWHXLD-FYFWZASSSA-N |
| XLogP | 3.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |