C19H34O4 — CID 70935603
6-[(7aR)-4-methoxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,4-dihydroxy-2-methylheptan-3-one (PubChem CID 70935603) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is 6-[(7aR)-4-methoxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,4-dihydroxy-2-methylheptan-3-one.
| Compound Name | 6-[(7aR)-4-methoxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,4-dihydroxy-2-methylheptan-3-one |
|---|---|
| PubChem CID | 70935603 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | 6-[(7aR)-4-methoxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,4-dihydroxy-2-methylheptan-3-one |
| SMILES | COC1CCC[C@]2(C)C(C(C)CC(O)C(=O)C(C)(C)O)CCC12 |
| InChI | InChI=1S/C19H34O4/c1-12(11-15(20)17(21)18(2,3)22)13-8-9-14-16(23-5)7-6-10-19(13,14)4/h12-16,20,22H,6-11H2,1-5H3/t12?,13?,14?,15?,16?,19-/m1/s1 |
| InChIKey | OWCVWLSHKNCATO-HXDXRCNISA-N |
| XLogP | 2.94 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |