C20H34O5 — CID 70184446
(2R,6R)-6-[(1R,7aS)-4-acetyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-hydroxy-2-methylheptanoic acid (PubChem CID 70184446) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is (2R,6R)-6-[(1R,7aS)-4-acetyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-hydroxy-2-methylheptanoic acid.
| Compound Name | (2R,6R)-6-[(1R,7aS)-4-acetyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-hydroxy-2-methylheptanoic acid |
|---|---|
| PubChem CID | 70184446 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (2R,6R)-6-[(1R,7aS)-4-acetyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-hydroxy-2-methylheptanoic acid |
| SMILES | CC(=O)OC1CCC[C@]2(C)C1CC[C@@H]2[C@H](C)CCC[C@@](C)(O)C(=O)O |
| InChI | InChI=1S/C20H34O5/c1-13(7-5-12-20(4,24)18(22)23)15-9-10-16-17(25-14(2)21)8-6-11-19(15,16)3/h13,15-17,24H,5-12H2,1-4H3,(H,22,23)/t13-,15-,16?,17?,19+,20-/m1/s1 |
| InChIKey | JZAQHOKMYULRCO-RCFJFRHVSA-N |
| XLogP | 3.78 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |