C29H52O5 — CID 143226975
[(1R,4S,7aR)-1-[(6R)-10-hydroxy-2-(2-hydroxypropan-2-yloxy)-2,10-dimethyl-3-methylideneundecan-6-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] acetate (PubChem CID 143226975) has the molecular formula C29H52O5 and a molecular weight of 480.73 g/mol. Its IUPAC name is [(1R,4S,7aR)-1-[(6R)-10-hydroxy-2-(2-hydroxypropan-2-yloxy)-2,10-dimethyl-3-methylideneundecan-6-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] acetate.
| Compound Name | [(1R,4S,7aR)-1-[(6R)-10-hydroxy-2-(2-hydroxypropan-2-yloxy)-2,10-dimethyl-3-methylideneundecan-6-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] acetate |
|---|---|
| PubChem CID | 143226975 |
| Molecular Formula | C29H52O5 |
| Molecular Weight | 480.73 g/mol |
| Exact Mass | 480.38 |
| IUPAC Name | [(1R,4S,7aR)-1-[(6R)-10-hydroxy-2-(2-hydroxypropan-2-yloxy)-2,10-dimethyl-3-methylideneundecan-6-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] acetate |
| SMILES | C=C(CC[C@@H](CCCC(C)(C)O)[C@H]1CCC2[C@@H](OC(C)=O)CCC[C@@]21C)C(C)(C)OC(C)(C)O |
| InChI | InChI=1S/C29H52O5/c1-20(27(5,6)34-28(7,8)32)14-15-22(12-10-18-26(3,4)31)23-16-17-24-25(33-21(2)30)13-11-19-29(23,24)9/h22-25,31-32H,1,10-19H2,2-9H3/t22-,23-,24?,25+,29-/m1/s1 |
| InChIKey | OUVAETPHUSKOOM-PXVJOYRGSA-N |
| XLogP | 6.55 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.73 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|