C23H44O4 — CID 143026027
(3R)-6-[(1R,4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,10-dimethylundecane-2,3,10-triol (PubChem CID 143026027) has the molecular formula C23H44O4 and a molecular weight of 384.60 g/mol. Its IUPAC name is (3R)-6-[(1R,4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,10-dimethylundecane-2,3,10-triol.
| Compound Name | (3R)-6-[(1R,4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,10-dimethylundecane-2,3,10-triol |
|---|---|
| PubChem CID | 143026027 |
| Molecular Formula | C23H44O4 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.32 |
| IUPAC Name | (3R)-6-[(1R,4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,10-dimethylundecane-2,3,10-triol |
| SMILES | CC(C)(O)CCCC(CC[C@@H](O)C(C)(C)O)[C@H]1CCC2[C@@H](O)CCC[C@@]21C |
| InChI | InChI=1S/C23H44O4/c1-21(2,26)14-6-8-16(10-13-20(25)22(3,4)27)17-11-12-18-19(24)9-7-15-23(17,18)5/h16-20,24-27H,6-15H2,1-5H3/t16?,17-,18?,19+,20-,23-/m1/s1 |
| InChIKey | OCLCRGZDMQEEPI-RHTBXHLBSA-N |
| XLogP | 4.03 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |