C16H30O — CID 59761037
(1R,3aR,4S,7aR)-1-[(3R)-hexan-3-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 59761037) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is (1R,3aR,4S,7aR)-1-[(3R)-hexan-3-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | (1R,3aR,4S,7aR)-1-[(3R)-hexan-3-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 59761037 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | (1R,3aR,4S,7aR)-1-[(3R)-hexan-3-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | CCC[C@@H](CC)[C@H]1CC[C@H]2[C@@H](O)CCC[C@]12C |
| InChI | InChI=1S/C16H30O/c1-4-7-12(5-2)13-9-10-14-15(17)8-6-11-16(13,14)3/h12-15,17H,4-11H2,1-3H3/t12-,13-,14+,15+,16-/m1/s1 |
| InChIKey | SAEHMBQZAMQNRT-RBGFHDKUSA-N |
| XLogP | 4.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |