C13H22O2 — CID 89262814
(2S)-2-(4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)propanal (PubChem CID 89262814) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (2S)-2-(4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)propanal.
| Compound Name | (2S)-2-(4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)propanal |
|---|---|
| PubChem CID | 89262814 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (2S)-2-(4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)propanal |
| SMILES | C[C@H](C=O)C1CCC2C(O)CCCC21C |
| InChI | InChI=1S/C13H22O2/c1-9(8-14)10-5-6-11-12(15)4-3-7-13(10,11)2/h8-12,15H,3-7H2,1-2H3/t9-,10?,11?,12?,13?/m1/s1 |
| InChIKey | PPLRFSVJYTZOMG-HIVKSXORSA-N |
| XLogP | 2.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|