C25H44O4 — CID 163564525
(3R)-5-[3-[(1R,4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-(4-hydroxy-4-methylpentyl)cyclopropen-1-yl]-2-methylpentane-2,3-diol (PubChem CID 163564525) has the molecular formula C25H44O4 and a molecular weight of 408.62 g/mol. Its IUPAC name is (3R)-5-[3-[(1R,4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-(4-hydroxy-4-methylpentyl)cyclopropen-1-yl]-2-methylpentane-2,3-diol.
| Compound Name | (3R)-5-[3-[(1R,4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-(4-hydroxy-4-methylpentyl)cyclopropen-1-yl]-2-methylpentane-2,3-diol |
|---|---|
| PubChem CID | 163564525 |
| Molecular Formula | C25H44O4 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | (3R)-5-[3-[(1R,4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-(4-hydroxy-4-methylpentyl)cyclopropen-1-yl]-2-methylpentane-2,3-diol |
| SMILES | CC(C)(O)CCCC1=C(CC[C@@H](O)C(C)(C)O)C1[C@H]1CCC2[C@@H](O)CCC[C@@]21C |
| InChI | InChI=1S/C25H44O4/c1-23(2,28)14-6-8-16-17(10-13-21(27)24(3,4)29)22(16)19-12-11-18-20(26)9-7-15-25(18,19)5/h18-22,26-29H,6-15H2,1-5H3/t18?,19-,20+,21-,22?,25+/m1/s1 |
| InChIKey | FUBIKQAUTTYUOU-XIIQLKGFSA-N |
| XLogP | 4.34 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|