C17H30O3 — CID 22880341
(1S,3aR,4S,7aR)-1-[3-(2-hydroxy-2-methylpropoxy)prop-1-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 22880341) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is (1S,3aR,4S,7aR)-1-[3-(2-hydroxy-2-methylpropoxy)prop-1-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | (1S,3aR,4S,7aR)-1-[3-(2-hydroxy-2-methylpropoxy)prop-1-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 22880341 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (1S,3aR,4S,7aR)-1-[3-(2-hydroxy-2-methylpropoxy)prop-1-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | C=C(COCC(C)(C)O)[C@H]1CC[C@H]2[C@@H](O)CCC[C@]12C |
| InChI | InChI=1S/C17H30O3/c1-12(10-20-11-16(2,3)19)13-7-8-14-15(18)6-5-9-17(13,14)4/h13-15,18-19H,1,5-11H2,2-4H3/t13-,14+,15+,17-/m1/s1 |
| InChIKey | YOCKBNITOSBNBZ-WBTNSWJXSA-N |
| XLogP | 2.91 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|