C19H34O3 — CID 21462526
1-[3-(2-ethyl-2-hydroxybutoxy)prop-1-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 21462526) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is 1-[3-(2-ethyl-2-hydroxybutoxy)prop-1-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | 1-[3-(2-ethyl-2-hydroxybutoxy)prop-1-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 21462526 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | 1-[3-(2-ethyl-2-hydroxybutoxy)prop-1-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | C=C(COCC(O)(CC)CC)C1CCC2C(O)CCCC12C |
| InChI | InChI=1S/C19H34O3/c1-5-19(21,6-2)13-22-12-14(3)15-9-10-16-17(20)8-7-11-18(15,16)4/h15-17,20-21H,3,5-13H2,1-2,4H3 |
| InChIKey | MYCPSWGBBIOADP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|