C25H46O5 — CID 58828505
[(4S,7aR)-7a-methyl-1-(2,3,10-trihydroxy-2,10-dimethylundecan-6-yl)-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] acetate (PubChem CID 58828505) has the molecular formula C25H46O5 and a molecular weight of 426.64 g/mol. Its IUPAC name is [(4S,7aR)-7a-methyl-1-(2,3,10-trihydroxy-2,10-dimethylundecan-6-yl)-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] acetate.
| Compound Name | [(4S,7aR)-7a-methyl-1-(2,3,10-trihydroxy-2,10-dimethylundecan-6-yl)-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] acetate |
|---|---|
| PubChem CID | 58828505 |
| Molecular Formula | C25H46O5 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.33 |
| IUPAC Name | [(4S,7aR)-7a-methyl-1-(2,3,10-trihydroxy-2,10-dimethylundecan-6-yl)-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCC[C@]2(C)C(C(CCCC(C)(C)O)CCC(O)C(C)(C)O)CCC12 |
| InChI | InChI=1S/C25H46O5/c1-17(26)30-21-10-8-16-25(6)19(12-13-20(21)25)18(9-7-15-23(2,3)28)11-14-22(27)24(4,5)29/h18-22,27-29H,7-16H2,1-6H3/t18?,19?,20?,21-,22?,25+/m0/s1 |
| InChIKey | ATXMIRMWMFCQAR-ZMFSMXQESA-N |
| XLogP | 4.60 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |