C24H44O5Si — CID 57270697
methyl (2R,6R)-6-[(1R,7aR)-4-acetyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methyl-2-trimethylsilyloxyheptanoate (PubChem CID 57270697) has the molecular formula C24H44O5Si and a molecular weight of 440.70 g/mol. Its IUPAC name is methyl (2R,6R)-6-[(1R,7aR)-4-acetyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methyl-2-trimethylsilyloxyheptanoate.
| Compound Name | methyl (2R,6R)-6-[(1R,7aR)-4-acetyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methyl-2-trimethylsilyloxyheptanoate |
|---|---|
| PubChem CID | 57270697 |
| Molecular Formula | C24H44O5Si |
| Molecular Weight | 440.70 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | methyl (2R,6R)-6-[(1R,7aR)-4-acetyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methyl-2-trimethylsilyloxyheptanoate |
| SMILES | COC(=O)[C@@](C)(CCC[C@@H](C)[C@H]1CCC2C(OC(C)=O)CCC[C@@]21C)O[Si](C)(C)C |
| InChI | InChI=1S/C24H44O5Si/c1-17(11-9-16-24(4,22(26)27-5)29-30(6,7)8)19-13-14-20-21(28-18(2)25)12-10-15-23(19,20)3/h17,19-21H,9-16H2,1-8H3/t17-,19-,20?,21?,23-,24-/m1/s1 |
| InChIKey | OBKWIDAYPXDVJG-WKAFLHSHSA-N |
| XLogP | 5.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.70 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|