C32H64O4Si2 — CID 59045693
[(1R,4S,7aR)-1-[(2R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] acetate (PubChem CID 59045693) has the molecular formula C32H64O4Si2 and a molecular weight of 569.03 g/mol. Its IUPAC name is [(1R,4S,7aR)-1-[(2R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] acetate.
| Compound Name | [(1R,4S,7aR)-1-[(2R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] acetate |
|---|---|
| PubChem CID | 59045693 |
| Molecular Formula | C32H64O4Si2 |
| Molecular Weight | 569.03 g/mol |
| Exact Mass | 568.43 |
| IUPAC Name | [(1R,4S,7aR)-1-[(2R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCC[C@@]2(C)C1CC[C@@H]2[C@H](C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H64O4Si2/c1-23(25-19-20-26-27(34-24(2)33)17-16-22-32(25,26)11)18-21-28(35-37(12,13)29(3,4)5)31(9,10)36-38(14,15)30(6,7)8/h23,25-28H,16-22H2,1-15H3/t23-,25-,26?,27+,28?,32-/m1/s1 |
| InChIKey | BWNOEKYYOWAIFQ-OPYAIMEGSA-N |
| XLogP | 9.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.03 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|