C21H36O5 — CID 57021321
methyl (2R,6R)-6-[(1R,7aR)-4-acetyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-hydroxy-2-methylheptanoate (PubChem CID 57021321) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is methyl (2R,6R)-6-[(1R,7aR)-4-acetyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-hydroxy-2-methylheptanoate.
| Compound Name | methyl (2R,6R)-6-[(1R,7aR)-4-acetyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-hydroxy-2-methylheptanoate |
|---|---|
| PubChem CID | 57021321 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | methyl (2R,6R)-6-[(1R,7aR)-4-acetyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-hydroxy-2-methylheptanoate |
| SMILES | COC(=O)[C@](C)(O)CCC[C@@H](C)[C@H]1CCC2C(OC(C)=O)CCC[C@@]21C |
| InChI | InChI=1S/C21H36O5/c1-14(8-6-13-21(4,24)19(23)25-5)16-10-11-17-18(26-15(2)22)9-7-12-20(16,17)3/h14,16-18,24H,6-13H2,1-5H3/t14-,16-,17?,18?,20-,21-/m1/s1 |
| InChIKey | HEXFKONMCFHKDI-GENHAVBISA-N |
| XLogP | 3.86 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |