C18H30O4 — CID 57131204
(2S,6R)-6-[(1R,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-hydroxy-2-methylheptanoic acid (PubChem CID 57131204) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is (2S,6R)-6-[(1R,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-hydroxy-2-methylheptanoic acid.
| Compound Name | (2S,6R)-6-[(1R,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-hydroxy-2-methylheptanoic acid |
|---|---|
| PubChem CID | 57131204 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | (2S,6R)-6-[(1R,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-hydroxy-2-methylheptanoic acid |
| SMILES | C[C@H](CCC[C@](C)(O)C(=O)O)[C@H]1CCC2C(=O)CCC[C@@]21C |
| InChI | InChI=1S/C18H30O4/c1-12(6-4-11-18(3,22)16(20)21)13-8-9-14-15(19)7-5-10-17(13,14)2/h12-14,22H,4-11H2,1-3H3,(H,20,21)/t12-,13-,14?,17-,18+/m1/s1 |
| InChIKey | NVPLSNNIGYITLO-KRPBBNOCSA-N |
| XLogP | 3.41 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |