C18H32O2S — CID 58420729
(1R,3aR,7aR)-7a-methyl-1-[(2R)-7,7,7-trideuterio-6-sulfanyloxy-6-(trideuteriomethyl)heptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 58420729) has the molecular formula C18H32O2S and a molecular weight of 318.56 g/mol. Its IUPAC name is (1R,3aR,7aR)-7a-methyl-1-[(2R)-7,7,7-trideuterio-6-sulfanyloxy-6-(trideuteriomethyl)heptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,3aR,7aR)-7a-methyl-1-[(2R)-7,7,7-trideuterio-6-sulfanyloxy-6-(trideuteriomethyl)heptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 58420729 |
| Molecular Formula | C18H32O2S |
| Molecular Weight | 318.56 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | (1R,3aR,7aR)-7a-methyl-1-[(2R)-7,7,7-trideuterio-6-sulfanyloxy-6-(trideuteriomethyl)heptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | [2H]C([2H])([2H])C(CCC[C@@H](C)[C@H]1CC[C@H]2C(=O)CCC[C@]12C)(OS)C([2H])([2H])[2H] |
| InChI | InChI=1S/C18H32O2S/c1-13(7-5-11-17(2,3)20-21)14-9-10-15-16(19)8-6-12-18(14,15)4/h13-15,21H,5-12H2,1-4H3/t13-,14-,15+,18-/m1/s1/i2D3,3D3 |
| InChIKey | YEKZGVQODNQZAZ-ZLCVAETDSA-N |
| XLogP | 5.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|